C15H20ClN3O2S — CID 119341058
(2S)-2-amino-N-[1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methylsulfanylbutanamide (PubChem CID 119341058) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119341058 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2S)-2-amino-N-[1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NC1CCN(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C15H20ClN3O2S/c1-22-8-6-12(17)14(20)18-13-5-7-19(15(13)21)11-4-2-3-10(16)9-11/h2-4,9,12-13H,5-8,17H2,1H3,(H,18,20)/t12-,13?/m0/s1 |
| InChIKey | DDSDCWBTIQFUCG-UEWDXFNNSA-N |
| XLogP | 1.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |