C17H25N3O4 — CID 119341793
2-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]pentanamide (PubChem CID 119341793) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]pentanamide.
| Compound Name | 2-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 119341793 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-amino-N-[1-(3,5-dimethoxyphenyl)-2-oxopyrrolidin-3-yl]pentanamide |
| SMILES | CCCC(N)C(=O)NC1CCN(c2cc(OC)cc(OC)c2)C1=O |
| InChI | InChI=1S/C17H25N3O4/c1-4-5-14(18)16(21)19-15-6-7-20(17(15)22)11-8-12(23-2)10-13(9-11)24-3/h8-10,14-15H,4-7,18H2,1-3H3,(H,19,21) |
| InChIKey | PIOSBCXFRZNXGX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |