C15H22ClN3OS — CID 104906806
(2R)-2-amino-1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 104906806) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2R)-2-amino-1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 104906806 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2R)-2-amino-1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@@H](N)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-21-10-5-14(17)15(20)19-8-6-18(7-9-19)13-4-2-3-12(16)11-13/h2-4,11,14H,5-10,17H2,1H3/t14-/m1/s1 |
| InChIKey | BYAVELORNBWCGO-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |