C20H24ClN3O5 — CID 167982774
2-[3-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-2-oxopyrrolidin-1-yl]-3-methylbutanoic acid (PubChem CID 167982774) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is 2-[3-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-2-oxopyrrolidin-1-yl]-3-methylbutanoic acid.
| Compound Name | 2-[3-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-2-oxopyrrolidin-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 167982774 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[3-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-2-oxopyrrolidin-1-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1CCC(NC(=O)C2CCN(c3cccc(Cl)c3)C2=O)C1=O |
| InChI | InChI=1S/C20H24ClN3O5/c1-11(2)16(20(28)29)24-9-7-15(19(24)27)22-17(25)14-6-8-23(18(14)26)13-5-3-4-12(21)10-13/h3-5,10-11,14-16H,6-9H2,1-2H3,(H,22,25)(H,28,29) |
| InChIKey | LZOGDUSCUCTJFR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|