C14H18BrN3O2 — CID 119406084
N-(3-aminopropyl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 119406084) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119406084 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3-aminopropyl)-1-(3-bromophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | NCCCNC(=O)C1CCN(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C14H18BrN3O2/c15-10-3-1-4-11(9-10)18-8-5-12(14(18)20)13(19)17-7-2-6-16/h1,3-4,9,12H,2,5-8,16H2,(H,17,19) |
| InChIKey | ZPCQSQVJBUXXBE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|