C20H21BrN2O4 — CID 52533801
(3R)-1-(3-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 52533801) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is (3R)-1-(3-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 52533801 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (3R)-1-(3-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@H]2CCN(c3cccc(Br)c3)C2=O)c1OC |
| InChI | InChI=1S/C20H21BrN2O4/c1-26-17-8-3-5-13(18(17)27-2)12-22-19(24)16-9-10-23(20(16)25)15-7-4-6-14(21)11-15/h3-8,11,16H,9-10,12H2,1-2H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | RKWHRBRQSGOZAQ-MRXNPFEDSA-N |
| XLogP | 3.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|