C20H29BrN2O3 — CID 4661436
methyl 2-[[1-[(3-bromophenyl)methyl]piperidine-4-carbonyl]amino]-4-methylpentanoate (PubChem CID 4661436) has the molecular formula C20H29BrN2O3 and a molecular weight of 425.37 g/mol. Its IUPAC name is methyl 2-[[1-[(3-bromophenyl)methyl]piperidine-4-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[1-[(3-bromophenyl)methyl]piperidine-4-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 4661436 |
| Molecular Formula | C20H29BrN2O3 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl 2-[[1-[(3-bromophenyl)methyl]piperidine-4-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C20H29BrN2O3/c1-14(2)11-18(20(25)26-3)22-19(24)16-7-9-23(10-8-16)13-15-5-4-6-17(21)12-15/h4-6,12,14,16,18H,7-11,13H2,1-3H3,(H,22,24) |
| InChIKey | TXJQRPZWCMZTEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |