C24H31BrN2O — CID 46776584
1-[(4-bromophenyl)methyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide (PubChem CID 46776584) has the molecular formula C24H31BrN2O and a molecular weight of 443.43 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46776584 |
| Molecular Formula | C24H31BrN2O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)CC(NC(=O)C1CCN(Cc2ccc(Br)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H31BrN2O/c1-18(2)16-23(20-6-4-3-5-7-20)26-24(28)21-12-14-27(15-13-21)17-19-8-10-22(25)11-9-19/h3-11,18,21,23H,12-17H2,1-2H3,(H,26,28) |
| InChIKey | OQVDULGBTJCHAI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |