C19H28BrN3O — CID 1096603
[1-[(3-bromophenyl)methyl]piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 1096603) has the molecular formula C19H28BrN3O and a molecular weight of 394.36 g/mol. Its IUPAC name is [1-[(3-bromophenyl)methyl]piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [1-[(3-bromophenyl)methyl]piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1096603 |
| Molecular Formula | C19H28BrN3O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [1-[(3-bromophenyl)methyl]piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)C2CCN(Cc3cccc(Br)c3)CC2)CC1 |
| InChI | InChI=1S/C19H28BrN3O/c1-2-21-10-12-23(13-11-21)19(24)17-6-8-22(9-7-17)15-16-4-3-5-18(20)14-16/h3-5,14,17H,2,6-13,15H2,1H3 |
| InChIKey | BDRSYFDJOXZFPT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |