C15H18Cl2N2O2 — CID 93331026
(3R)-N-[(2S)-butan-2-yl]-1-(2,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 93331026) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is (3R)-N-[(2S)-butan-2-yl]-1-(2,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-butan-2-yl]-1-(2,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93331026 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (3R)-N-[(2S)-butan-2-yl]-1-(2,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC[C@H](C)NC(=O)[C@H]1CCN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-3-9(2)18-14(20)11-6-7-19(15(11)21)13-5-4-10(16)8-12(13)17/h4-5,8-9,11H,3,6-7H2,1-2H3,(H,18,20)/t9-,11+/m0/s1 |
| InChIKey | HKGVKNPTCDCNMW-GXSJLCMTSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|