C26H35N3O2 — CID 123991953
benzyl N-[2-[[1-(4-methylphenyl)piperidin-3-yl]amino]cyclohexyl]carbamate (PubChem CID 123991953) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is benzyl N-[2-[[1-(4-methylphenyl)piperidin-3-yl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-[[1-(4-methylphenyl)piperidin-3-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123991953 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | benzyl N-[2-[[1-(4-methylphenyl)piperidin-3-yl]amino]cyclohexyl]carbamate |
| SMILES | Cc1ccc(N2CCCC(NC3CCCCC3NC(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-20-13-15-23(16-14-20)29-17-7-10-22(18-29)27-24-11-5-6-12-25(24)28-26(30)31-19-21-8-3-2-4-9-21/h2-4,8-9,13-16,22,24-25,27H,5-7,10-12,17-19H2,1H3,(H,28,30) |
| InChIKey | YEKNNRWARCFQPC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|