C15H20N2O2 — CID 11425456
benzyl N-[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]carbamate (PubChem CID 11425456) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is benzyl N-[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]carbamate.
| Compound Name | benzyl N-[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]carbamate |
|---|---|
| PubChem CID | 11425456 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | benzyl N-[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]carbamate |
| SMILES | O=C(N[C@H]1CCN2CCC[C@H]12)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c18-15(19-11-12-5-2-1-3-6-12)16-13-8-10-17-9-4-7-14(13)17/h1-3,5-6,13-14H,4,7-11H2,(H,16,18)/t13-,14+/m0/s1 |
| InChIKey | VCCZEKMUDRYGAQ-UONOGXRCSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |