C15H18N2O6 — CID 145450382
(3S,4S)-4-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylic acid (PubChem CID 145450382) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is (3S,4S)-4-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylic acid.
| Compound Name | (3S,4S)-4-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 145450382 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3S,4S)-4-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylic acid |
| SMILES | O=C(N[C@H]1CCN(C(=O)O)C[C@@H]1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18N2O6/c18-13(19)11-8-17(15(21)22)7-6-12(11)16-14(20)23-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,16,20)(H,18,19)(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | URQWNVMSRBCGTH-RYUDHWBXSA-N |
| XLogP | 1.37 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |