C19H29N3O2 — CID 111631043
1-[2-(hydroxymethyl)cyclohexyl]-3-(1-phenylpiperidin-3-yl)urea (PubChem CID 111631043) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-phenylpiperidin-3-yl)urea.
| Compound Name | 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-phenylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 111631043 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-phenylpiperidin-3-yl)urea |
| SMILES | O=C(NC1CCCN(c2ccccc2)C1)NC1CCCCC1CO |
| InChI | InChI=1S/C19H29N3O2/c23-14-15-7-4-5-11-18(15)21-19(24)20-16-8-6-12-22(13-16)17-9-2-1-3-10-17/h1-3,9-10,15-16,18,23H,4-8,11-14H2,(H2,20,21,24) |
| InChIKey | CKMIKAJDRJBWLQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |