C18H20N2O3 — CID 99635756
3,5-dihydroxy-N-[(3R)-1-phenylpiperidin-3-yl]benzamide (PubChem CID 99635756) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(3R)-1-phenylpiperidin-3-yl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(3R)-1-phenylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 99635756 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3,5-dihydroxy-N-[(3R)-1-phenylpiperidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCCN(c2ccccc2)C1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C18H20N2O3/c21-16-9-13(10-17(22)11-16)18(23)19-14-5-4-8-20(12-14)15-6-2-1-3-7-15/h1-3,6-7,9-11,14,21-22H,4-5,8,12H2,(H,19,23)/t14-/m1/s1 |
| InChIKey | KIZOECOBJCSFRL-CQSZACIVSA-N |
| XLogP | 2.50 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |