C13H15NO5 — CID 117008801
4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carboxylic acid (PubChem CID 117008801) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carboxylic acid.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 117008801 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc3c(c2)OCCO3)CCO1 |
| InChI | InChI=1S/C13H15NO5/c15-13(16)12-8-14(3-4-17-12)9-1-2-10-11(7-9)19-6-5-18-10/h1-2,7,12H,3-6,8H2,(H,15,16) |
| InChIKey | HJHKYFYTGDSICD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|