C13H14N2O3 — CID 117009780
4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carbonitrile (PubChem CID 117009780) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carbonitrile.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 117009780 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(c2ccc3c(c2)OCCO3)CCO1 |
| InChI | InChI=1S/C13H14N2O3/c14-8-11-9-15(3-4-16-11)10-1-2-12-13(7-10)18-6-5-17-12/h1-2,7,11H,3-6,9H2 |
| InChIKey | NHJYJTQGCLMDBG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|