C11H14N4O — CID 106750984
4-(3,4-diaminophenyl)morpholine-2-carbonitrile (PubChem CID 106750984) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)morpholine-2-carbonitrile.
| Compound Name | 4-(3,4-diaminophenyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 106750984 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(3,4-diaminophenyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(c2ccc(N)c(N)c2)CCO1 |
| InChI | InChI=1S/C11H14N4O/c12-6-9-7-15(3-4-16-9)8-1-2-10(13)11(14)5-8/h1-2,5,9H,3-4,7,13-14H2 |
| InChIKey | VDYXOICKOVJYAK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|