C13H14N2O5S — CID 11913811
(4aS,7aR)-1-(1,3-benzodioxol-5-yl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 11913811) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is (4aS,7aR)-1-(1,3-benzodioxol-5-yl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-1-(1,3-benzodioxol-5-yl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 11913811 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4aS,7aR)-1-(1,3-benzodioxol-5-yl)-6,6-dioxo-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1CN(c2ccc3c(c2)OCO3)[C@H]2CS(=O)(=O)C[C@H]2N1 |
| InChI | InChI=1S/C13H14N2O5S/c16-13-4-15(10-6-21(17,18)5-9(10)14-13)8-1-2-11-12(3-8)20-7-19-11/h1-3,9-10H,4-7H2,(H,14,16)/t9-,10+/m1/s1 |
| InChIKey | GZEYUJUPGNSSHI-ZJUUUORDSA-N |
| XLogP | -0.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|