C13H13F3N2O3S — CID 11913844
(4aS,7aR)-6,6-dioxo-1-[4-(trifluoromethyl)phenyl]-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 11913844) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is (4aS,7aR)-6,6-dioxo-1-[4-(trifluoromethyl)phenyl]-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-6,6-dioxo-1-[4-(trifluoromethyl)phenyl]-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 11913844 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (4aS,7aR)-6,6-dioxo-1-[4-(trifluoromethyl)phenyl]-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1CN(c2ccc(C(F)(F)F)cc2)[C@H]2CS(=O)(=O)C[C@H]2N1 |
| InChI | InChI=1S/C13H13F3N2O3S/c14-13(15,16)8-1-3-9(4-2-8)18-5-12(19)17-10-6-22(20,21)7-11(10)18/h1-4,10-11H,5-7H2,(H,17,19)/t10-,11+/m1/s1 |
| InChIKey | DVGKOOJBOIXMCC-MNOVXSKESA-N |
| XLogP | 0.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |