C18H18N2O4S — CID 11913848
(4aS,7aR)-6,6-dioxo-1-(4-phenoxyphenyl)-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 11913848) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (4aS,7aR)-6,6-dioxo-1-(4-phenoxyphenyl)-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-6,6-dioxo-1-(4-phenoxyphenyl)-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 11913848 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (4aS,7aR)-6,6-dioxo-1-(4-phenoxyphenyl)-2,4,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1CN(c2ccc(Oc3ccccc3)cc2)[C@H]2CS(=O)(=O)C[C@H]2N1 |
| InChI | InChI=1S/C18H18N2O4S/c21-18-10-20(17-12-25(22,23)11-16(17)19-18)13-6-8-15(9-7-13)24-14-4-2-1-3-5-14/h1-9,16-17H,10-12H2,(H,19,21)/t16-,17+/m1/s1 |
| InChIKey | WFYSXYCFYGNIKI-SJORKVTESA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |