C21H16ClNO4S — CID 3875714
2-(4-chlorophenyl)-1,1-dioxo-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3875714) has the molecular formula C21H16ClNO4S and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,1-dioxo-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-1,1-dioxo-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3875714 |
| Molecular Formula | C21H16ClNO4S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-(4-chlorophenyl)-1,1-dioxo-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS(=O)(=O)C(c2ccc(Cl)cc2)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H16ClNO4S/c22-16-8-6-15(7-9-16)21-23(20(24)14-28(21,25)26)17-10-12-19(13-11-17)27-18-4-2-1-3-5-18/h1-13,21H,14H2 |
| InChIKey | NAINPPQGHYFAOO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |