C21H17NO2S — CID 6935175
(2S)-3-(4-phenoxyphenyl)-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 6935175) has the molecular formula C21H17NO2S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S)-3-(4-phenoxyphenyl)-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-(4-phenoxyphenyl)-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6935175 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (2S)-3-(4-phenoxyphenyl)-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@@H](c2ccccc2)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO2S/c23-20-15-25-21(16-7-3-1-4-8-16)22(20)17-11-13-19(14-12-17)24-18-9-5-2-6-10-18/h1-14,21H,15H2/t21-/m0/s1 |
| InChIKey | FJXQPSWQRXSPMD-NRFANRHFSA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |