C23H21NO3S — CID 1274921
(2R)-3-(4-ethoxyphenyl)-2-(4-phenoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 1274921) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2R)-3-(4-ethoxyphenyl)-2-(4-phenoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2R)-3-(4-ethoxyphenyl)-2-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1274921 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2R)-3-(4-ethoxyphenyl)-2-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)CS[C@@H]2c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-2-26-19-14-10-18(11-15-19)24-22(25)16-28-23(24)17-8-12-21(13-9-17)27-20-6-4-3-5-7-20/h3-15,23H,2,16H2,1H3/t23-/m1/s1 |
| InChIKey | DQJXHZCGEZBYJH-HSZRJFAPSA-N |
| XLogP | 5.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |