C18H17NO4S — CID 13317425
2-(1,3-benzodioxol-5-yl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 13317425) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 13317425 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)CSC2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H17NO4S/c1-2-21-14-6-4-13(5-7-14)19-17(20)10-24-18(19)12-3-8-15-16(9-12)23-11-22-15/h3-9,18H,2,10-11H2,1H3 |
| InChIKey | VBOSFDIZWORTRT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |