C24H23NO5S2 — CID 56968142
[4-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 56968142) has the molecular formula C24H23NO5S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is [4-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56968142 |
| Molecular Formula | C24H23NO5S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [4-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1ccc(N2C(=O)CSC2c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO5S2/c1-3-29-20-12-8-19(9-13-20)25-23(26)16-31-24(25)18-6-10-21(11-7-18)30-32(27,28)22-14-4-17(2)5-15-22/h4-15,24H,3,16H2,1-2H3 |
| InChIKey | YKLPNQOYPUCPMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|