C18H18N2O4 — CID 124504201
(3S,4R)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)azetidin-2-one (PubChem CID 124504201) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124504201 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3S,4R)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)azetidin-2-one |
| SMILES | CCOc1ccc(N2C(=O)[C@@H](N)[C@H]2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-2-22-13-6-4-12(5-7-13)20-17(16(19)18(20)21)11-3-8-14-15(9-11)24-10-23-14/h3-9,16-17H,2,10,19H2,1H3/t16-,17+/m0/s1 |
| InChIKey | GQSLLKBRBRASEN-DLBZAZTESA-N |
| XLogP | 2.23 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |