C15H13NO3S — CID 824881
(2R)-1,1-dioxo-2,3-diphenyl-1,3-thiazolidin-4-one (PubChem CID 824881) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2R)-1,1-dioxo-2,3-diphenyl-1,3-thiazolidin-4-one.
| Compound Name | (2R)-1,1-dioxo-2,3-diphenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 824881 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (2R)-1,1-dioxo-2,3-diphenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CS(=O)(=O)[C@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C15H13NO3S/c17-14-11-20(18,19)15(12-7-3-1-4-8-12)16(14)13-9-5-2-6-10-13/h1-10,15H,11H2/t15-/m1/s1 |
| InChIKey | RQEIAMDCJRURGH-OAHLLOKOSA-N |
| XLogP | 2.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |