C14H18ClN3O2 — CID 79348767
5-chloro-3-(methylamino)-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one (PubChem CID 79348767) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-3-(methylamino)-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(methylamino)-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79348767 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-chloro-3-(methylamino)-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(N3CCCOCC3)c(Cl)cc21 |
| InChI | InChI=1S/C14H18ClN3O2/c1-16-13-9-7-10(15)12(8-11(9)17-14(13)19)18-3-2-5-20-6-4-18/h7-8,13,16H,2-6H2,1H3,(H,17,19) |
| InChIKey | CYWZHDNWLRISCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|