C15H21ClN4O — CID 79342702
5-chloro-6-(4-ethylpiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 79342702) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-chloro-6-(4-ethylpiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-(4-ethylpiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79342702 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-chloro-6-(4-ethylpiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CCN1CCN(c2cc3c(cc2Cl)C(NC)C(=O)N3)CC1 |
| InChI | InChI=1S/C15H21ClN4O/c1-3-19-4-6-20(7-5-19)13-9-12-10(8-11(13)16)14(17-2)15(21)18-12/h8-9,14,17H,3-7H2,1-2H3,(H,18,21) |
| InChIKey | HSLZBRWGXKMWHW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|