C15H20ClN3O — CID 79349803
3-amino-5-chloro-6-(3-ethylpiperidin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 79349803) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-amino-5-chloro-6-(3-ethylpiperidin-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-5-chloro-6-(3-ethylpiperidin-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79349803 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-amino-5-chloro-6-(3-ethylpiperidin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CCC1CCCN(c2cc3c(cc2Cl)C(N)C(=O)N3)C1 |
| InChI | InChI=1S/C15H20ClN3O/c1-2-9-4-3-5-19(8-9)13-7-12-10(6-11(13)16)14(17)15(20)18-12/h6-7,9,14H,2-5,8,17H2,1H3,(H,18,20) |
| InChIKey | FSWBCGSFZOVPBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |