C14H17ClN2O3 — CID 79348953
5-chloro-3-(methylamino)-6-(oxan-4-yloxy)-1,3-dihydroindol-2-one (PubChem CID 79348953) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 5-chloro-3-(methylamino)-6-(oxan-4-yloxy)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(methylamino)-6-(oxan-4-yloxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79348953 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-chloro-3-(methylamino)-6-(oxan-4-yloxy)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(OC3CCOCC3)c(Cl)cc21 |
| InChI | InChI=1S/C14H17ClN2O3/c1-16-13-9-6-10(15)12(7-11(9)17-14(13)18)20-8-2-4-19-5-3-8/h6-8,13,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | MMFVKTDCFYOGGR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |