C15H19FN2O3 — CID 106836471
5-fluoro-3-hydroxy-6-[4-(1-hydroxyethyl)piperidin-1-yl]-1,3-dihydroindol-2-one (PubChem CID 106836471) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-6-[4-(1-hydroxyethyl)piperidin-1-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-6-[4-(1-hydroxyethyl)piperidin-1-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106836471 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 5-fluoro-3-hydroxy-6-[4-(1-hydroxyethyl)piperidin-1-yl]-1,3-dihydroindol-2-one |
| SMILES | CC(O)C1CCN(c2cc3c(cc2F)C(O)C(=O)N3)CC1 |
| InChI | InChI=1S/C15H19FN2O3/c1-8(19)9-2-4-18(5-3-9)13-7-12-10(6-11(13)16)14(20)15(21)17-12/h6-9,14,19-20H,2-5H2,1H3,(H,17,21) |
| InChIKey | XSSQQDOCVOAMDA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|