C15H20FN3O2 — CID 80747351
6-(4-ethyl-3-methylpiperazin-1-yl)-5-fluoro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 80747351) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 6-(4-ethyl-3-methylpiperazin-1-yl)-5-fluoro-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-(4-ethyl-3-methylpiperazin-1-yl)-5-fluoro-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80747351 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 6-(4-ethyl-3-methylpiperazin-1-yl)-5-fluoro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCN1CCN(c2cc3c(cc2F)C(O)C(=O)N3)CC1C |
| InChI | InChI=1S/C15H20FN3O2/c1-3-18-4-5-19(8-9(18)2)13-7-12-10(6-11(13)16)14(20)15(21)17-12/h6-7,9,14,20H,3-5,8H2,1-2H3,(H,17,21) |
| InChIKey | NZDCKFXPOWVDMR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|