C15H17ClN2O2 — CID 115560542
6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-chloro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 115560542) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-chloro-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115560542 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(N3CC4CCCC4C3)c(Cl)cc2C1O |
| InChI | InChI=1S/C15H17ClN2O2/c16-11-4-10-12(17-15(20)14(10)19)5-13(11)18-6-8-2-1-3-9(8)7-18/h4-5,8-9,14,19H,1-3,6-7H2,(H,17,20) |
| InChIKey | VCMZVRBHAMWSQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|