C17H18N4O6 — CID 5039765
7-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrophenyl]-8-oxa-2,4-diazabicyclo[4.2.0]oct-1(6)-ene-3,5-dione (PubChem CID 5039765) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 7-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrophenyl]-8-oxa-2,4-diazabicyclo[4.2.0]oct-1(6)-ene-3,5-dione.
| Compound Name | 7-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrophenyl]-8-oxa-2,4-diazabicyclo[4.2.0]oct-1(6)-ene-3,5-dione |
|---|---|
| PubChem CID | 5039765 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 7-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrophenyl]-8-oxa-2,4-diazabicyclo[4.2.0]oct-1(6)-ene-3,5-dione |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2C2Oc3[nH]c(=O)[nH]c(=O)c32)CC(C)O1 |
| InChI | InChI=1S/C17H18N4O6/c1-8-6-20(7-9(2)26-8)12-4-3-10(21(24)25)5-11(12)14-13-15(22)18-17(23)19-16(13)27-14/h3-5,8-9,14H,6-7H2,1-2H3,(H2,18,19,22,23) |
| InChIKey | FXBWIFOLXHOIMD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|