C23H22ClN3O7 — CID 70201105
1-(4-chlorophenyl)pyrrole-2,5-dione;2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid (PubChem CID 70201105) has the molecular formula C23H22ClN3O7 and a molecular weight of 487.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)pyrrole-2,5-dione;2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid.
| Compound Name | 1-(4-chlorophenyl)pyrrole-2,5-dione;2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 70201105 |
| Molecular Formula | C23H22ClN3O7 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 1-(4-chlorophenyl)pyrrole-2,5-dione;2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2C(=O)O)CC(C)O1.O=C1C=CC(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16N2O5.C10H6ClNO2/c1-8-6-14(7-9(2)20-8)12-4-3-10(15(18)19)5-11(12)13(16)17;11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h3-5,8-9H,6-7H2,1-2H3,(H,16,17);1-6H |
| InChIKey | SDYWTPLDJIFQLS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|