C13H16N2O5 — CID 26598019
5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-nitrobenzoic acid (PubChem CID 26598019) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-nitrobenzoic acid.
| Compound Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 26598019 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-nitrobenzoic acid |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])c(C(=O)O)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H16N2O5/c1-8-6-14(7-9(2)20-8)10-3-4-12(15(18)19)11(5-10)13(16)17/h3-5,8-9H,6-7H2,1-2H3,(H,16,17)/t8-,9+ |
| InChIKey | VWTUGTCIUKZKLA-DTORHVGOSA-N |
| XLogP | 1.91 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|