C13H16N2O6 — CID 103534328
4-(3,4-dimethoxypyrrolidin-1-yl)-2-nitrobenzoic acid (PubChem CID 103534328) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-2-nitrobenzoic acid.
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 103534328 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-2-nitrobenzoic acid |
| SMILES | COC1CN(c2ccc(C(=O)O)c([N+](=O)[O-])c2)CC1OC |
| InChI | InChI=1S/C13H16N2O6/c1-20-11-6-14(7-12(11)21-2)8-3-4-9(13(16)17)10(5-8)15(18)19/h3-5,11-12H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | YAOWIMYRCKMBDV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|