C13H18ClN3O4 — CID 129186311
4-(4-ethylpiperazin-1-yl)-2-nitrobenzoic acid;hydrochloride (PubChem CID 129186311) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-2-nitrobenzoic acid;hydrochloride.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-2-nitrobenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 129186311 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-2-nitrobenzoic acid;hydrochloride |
| SMILES | CCN1CCN(c2ccc(C(=O)O)c([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C13H17N3O4.ClH/c1-2-14-5-7-15(8-6-14)10-3-4-11(13(17)18)12(9-10)16(19)20;/h3-4,9H,2,5-8H2,1H3,(H,17,18);1H |
| InChIKey | KZUWYLWWVKWHCQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|