C13H16N2O6 — CID 102933153
5-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-nitrobenzoic acid (PubChem CID 102933153) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-nitrobenzoic acid.
| Compound Name | 5-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 102933153 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-nitrobenzoic acid |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])c(C(=O)O)c2)CC(CO)O1 |
| InChI | InChI=1S/C13H16N2O6/c1-8-5-14(6-10(7-16)21-8)9-2-3-12(15(19)20)11(4-9)13(17)18/h2-4,8,10,16H,5-7H2,1H3,(H,17,18) |
| InChIKey | LVSPEVPMOHBDHT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|