C25H29FN4O5 — CID 59793571
1-[4-[4-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone (PubChem CID 59793571) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is 1-[4-[4-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-[4-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 59793571 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-[4-[4-[2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3N3CC(C)OC(C)C3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H29FN4O5/c1-16-14-29(15-17(2)35-16)23-7-5-20(30(33)34)13-21(23)25(32)28-10-8-27(9-11-28)24-6-4-19(18(3)31)12-22(24)26/h4-7,12-13,16-17H,8-11,14-15H2,1-3H3 |
| InChIKey | MKWWDZIWGQMQFY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|