C26H24FN3O5 — CID 59853645
1-[3-fluoro-4-[4-[2-(4-methoxyphenyl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 59853645) has the molecular formula C26H24FN3O5 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[2-(4-methoxyphenyl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-[2-(4-methoxyphenyl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 59853645 |
| Molecular Formula | C26H24FN3O5 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-[3-fluoro-4-[4-[2-(4-methoxyphenyl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | COc1ccc(-c2ccc([N+](=O)[O-])cc2C(=O)N2CCN(c3ccc(C(C)=O)cc3F)CC2)cc1 |
| InChI | InChI=1S/C26H24FN3O5/c1-17(31)19-5-10-25(24(27)15-19)28-11-13-29(14-12-28)26(32)23-16-20(30(33)34)6-9-22(23)18-3-7-21(35-2)8-4-18/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | KERFOOQUIPTGNG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|