C25H30FN5O4 — CID 2885266
1-[3-fluoro-4-[4-[2-(4-methylpiperazin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]propan-1-one (PubChem CID 2885266) has the molecular formula C25H30FN5O4 and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[2-(4-methylpiperazin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]propan-1-one.
| Compound Name | 1-[3-fluoro-4-[4-[2-(4-methylpiperazin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 2885266 |
| Molecular Formula | C25H30FN5O4 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 1-[3-fluoro-4-[4-[2-(4-methylpiperazin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3N3CCN(C)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H30FN5O4/c1-3-24(32)18-4-6-23(21(26)16-18)29-12-14-30(15-13-29)25(33)20-17-19(31(34)35)5-7-22(20)28-10-8-27(2)9-11-28/h4-7,16-17H,3,8-15H2,1-2H3 |
| InChIKey | AWKVHISJBMJMNQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|