C20H18ClF3N2O2 — CID 1282871
1-[4-[4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-3-fluorophenyl]propan-1-one (PubChem CID 1282871) has the molecular formula C20H18ClF3N2O2 and a molecular weight of 410.82 g/mol. Its IUPAC name is 1-[4-[4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-3-fluorophenyl]propan-1-one.
| Compound Name | 1-[4-[4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-3-fluorophenyl]propan-1-one |
|---|---|
| PubChem CID | 1282871 |
| Molecular Formula | C20H18ClF3N2O2 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[4-[4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-3-fluorophenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(N2CCN(C(=O)c3cc(F)c(F)cc3Cl)CC2)c(F)c1 |
| InChI | InChI=1S/C20H18ClF3N2O2/c1-2-19(27)12-3-4-18(17(24)9-12)25-5-7-26(8-6-25)20(28)13-10-15(22)16(23)11-14(13)21/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | HORWHGPZYJWKAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|