C19H17Cl2FN2O2 — CID 599707
1-[4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]ethanone (PubChem CID 599707) has the molecular formula C19H17Cl2FN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 1-[4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 599707 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c(F)c1 |
| InChI | InChI=1S/C19H17Cl2FN2O2/c1-12(25)13-2-5-18(17(22)10-13)23-6-8-24(9-7-23)19(26)15-4-3-14(20)11-16(15)21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | SDRWBAXEACXORH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |