C20H17Cl2N3O2 — CID 133456096
4-acetyl-3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 133456096) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 4-acetyl-3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 4-acetyl-3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133456096 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-acetyl-3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-13(26)16-4-2-14(12-23)10-19(16)24-6-8-25(9-7-24)20(27)17-5-3-15(21)11-18(17)22/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | VNWIZJLFFQYFKU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |