C19H16Cl3FN2O3 — CID 112813678
1-[3-fluoro-4-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 112813678) has the molecular formula C19H16Cl3FN2O3 and a molecular weight of 445.71 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 112813678 |
| Molecular Formula | C19H16Cl3FN2O3 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 1-[3-fluoro-4-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3c(O)c(Cl)cc(Cl)c3Cl)CC2)c(F)c1 |
| InChI | InChI=1S/C19H16Cl3FN2O3/c1-10(26)11-2-3-15(14(23)8-11)24-4-6-25(7-5-24)19(28)16-17(22)12(20)9-13(21)18(16)27/h2-3,8-9,27H,4-7H2,1H3 |
| InChIKey | DXHXZCHVQQUUTA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|