C47H48F2N8O7 — CID 174497103
2,4-bis[4-[4-[2-(2,5-dihydropyrrol-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]pentan-3-one (PubChem CID 174497103) has the molecular formula C47H48F2N8O7 and a molecular weight of 874.95 g/mol. Its IUPAC name is 2,4-bis[4-[4-[2-(2,5-dihydropyrrol-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[4-[2-(2,5-dihydropyrrol-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]pentan-3-one |
|---|---|
| PubChem CID | 174497103 |
| Molecular Formula | C47H48F2N8O7 |
| Molecular Weight | 874.95 g/mol |
| Exact Mass | 874.36 |
| IUPAC Name | 2,4-bis[4-[4-[2-(2,5-dihydropyrrol-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3N3CC=CC3)CC2)c(F)c1)c1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3N3CC=CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C47H48F2N8O7/c1-31(33-7-11-43(39(48)27-33)52-19-23-54(24-20-52)46(59)37-29-35(56(61)62)9-13-41(37)50-15-3-4-16-50)45(58)32(2)34-8-12-44(40(49)28-34)53-21-25-55(26-22-53)47(60)38-30-36(57(63)64)10-14-42(38)51-17-5-6-18-51/h3-14,27-32H,15-26H2,1-2H3 |
| InChIKey | BTSATSXUFVEYLI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 156.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.95 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|