C18H19FN4O3 — CID 24531603
[4-(2-fluorophenyl)piperazin-1-yl]-[2-(methylamino)-5-nitrophenyl]methanone (PubChem CID 24531603) has the molecular formula C18H19FN4O3 and a molecular weight of 358.37 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[2-(methylamino)-5-nitrophenyl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[2-(methylamino)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 24531603 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[2-(methylamino)-5-nitrophenyl]methanone |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H19FN4O3/c1-20-16-7-6-13(23(25)26)12-14(16)18(24)22-10-8-21(9-11-22)17-5-3-2-4-15(17)19/h2-7,12,20H,8-11H2,1H3 |
| InChIKey | WQGQPEOEKDGGQH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|